C10H17NO5S — CID 7732470
ethyl 2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoacetate (PubChem CID 7732470) has the molecular formula C10H17NO5S and a molecular weight of 263.31 g/mol. Its IUPAC name is ethyl 2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoacetate.
| Compound Name | ethyl 2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoacetate |
|---|---|
| PubChem CID | 7732470 |
| Molecular Formula | C10H17NO5S |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | ethyl 2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)N(CC)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H17NO5S/c1-3-11(9(12)10(13)16-4-2)8-5-6-17(14,15)7-8/h8H,3-7H2,1-2H3/t8-/m1/s1 |
| InChIKey | YIIXKHGEJOZSMV-MRVPVSSYSA-N |
| XLogP | -0.41 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|