ethyl 2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoacetate

C10H17NO5S — CID 7732470

IUPACethyl 2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoacetate
SMILESCCOC(=O)C(=O)N(CC)[C@@H]1CCS(=O)(=O)C1
InChIInChI=1S/C10H17NO5S/c1-3-11(9(12)10(13)16-4-2)8-5-6-17(14,15)7-8/h8H,3-7H2,1-2H3/t8-/m1/s1
InChIKeyYIIXKHGEJOZSMV-MRVPVSSYSA-N
MW263.31 g/mol
LogP-0.41
Rot. Bonds3

About ethyl 2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoacetate

ethyl 2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoacetate (PubChem CID 7732470) has the molecular formula C10H17NO5S and a molecular weight of 263.31 g/mol. Its IUPAC name is ethyl 2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoacetate.

Molecular Properties

Compound Nameethyl 2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoacetate
PubChem CID7732470
Molecular FormulaC10H17NO5S
Molecular Weight263.31 g/mol
Exact Mass263.08
IUPAC Nameethyl 2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoacetate
SMILESCCOC(=O)C(=O)N(CC)[C@@H]1CCS(=O)(=O)C1
InChIInChI=1S/C10H17NO5S/c1-3-11(9(12)10(13)16-4-2)8-5-6-17(14,15)7-8/h8H,3-7H2,1-2H3/t8-/m1/s1
InChIKeyYIIXKHGEJOZSMV-MRVPVSSYSA-N
XLogP-0.41
TPSA80.75 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.31
LogP ≤ 5-0.41
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze ethyl 2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoacetate?
The IUPAC name of ethyl 2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoacetate (CID 7732470) is ethyl 2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoacetate.
What is the SMILES notation for ethyl 2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoacetate?
The canonical SMILES for ethyl 2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoacetate is CCOC(=O)C(=O)N(CC)[C@@H]1CCS(=O)(=O)C1.
What is the InChIKey of ethyl 2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoacetate?
The InChIKey is YIIXKHGEJOZSMV-MRVPVSSYSA-N. The full InChI is InChI=1S/C10H17NO5S/c1-3-11(9(12)10(13)16-4-2)8-5-6-17(14,15)7-8/h8H,3-7H2,1-2H3/t8-/m1/s1.
What are the key properties of ethyl 2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoacetate?
ethyl 2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoacetate has a molecular weight of 263.31 g/mol, XLogP of -0.41, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoacetate is sourced from PubChem (CID 7732470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).