C14H28N2O3S — CID 109003505
N-(1,1-dioxothiolan-3-yl)-2-(dipropylamino)-N-ethylacetamide (PubChem CID 109003505) has the molecular formula C14H28N2O3S and a molecular weight of 304.46 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-(dipropylamino)-N-ethylacetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-(dipropylamino)-N-ethylacetamide |
|---|---|
| PubChem CID | 109003505 |
| Molecular Formula | C14H28N2O3S |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-(dipropylamino)-N-ethylacetamide |
| SMILES | CCCN(CCC)CC(=O)N(CC)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H28N2O3S/c1-4-8-15(9-5-2)11-14(17)16(6-3)13-7-10-20(18,19)12-13/h13H,4-12H2,1-3H3 |
| InChIKey | PUFXJRXQOQZPKJ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |