C11H19NO5S — CID 43399752
5-[(1,1-dioxothiolan-3-yl)-ethylamino]-5-oxopentanoic acid (PubChem CID 43399752) has the molecular formula C11H19NO5S and a molecular weight of 277.34 g/mol. Its IUPAC name is 5-[(1,1-dioxothiolan-3-yl)-ethylamino]-5-oxopentanoic acid.
| Compound Name | 5-[(1,1-dioxothiolan-3-yl)-ethylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 43399752 |
| Molecular Formula | C11H19NO5S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 5-[(1,1-dioxothiolan-3-yl)-ethylamino]-5-oxopentanoic acid |
| SMILES | CCN(C(=O)CCCC(=O)O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H19NO5S/c1-2-12(9-6-7-18(16,17)8-9)10(13)4-3-5-11(14)15/h9H,2-8H2,1H3,(H,14,15) |
| InChIKey | CVSGYANESNEZCH-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |