C15H25N3O6S — CID 108527015
ethyl 4-[2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoacetyl]piperazine-1-carboxylate (PubChem CID 108527015) has the molecular formula C15H25N3O6S and a molecular weight of 375.45 g/mol. Its IUPAC name is ethyl 4-[2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoacetyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoacetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 108527015 |
| Molecular Formula | C15H25N3O6S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | ethyl 4-[2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoacetyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)C(=O)N(CC)C2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C15H25N3O6S/c1-3-18(12-5-10-25(22,23)11-12)14(20)13(19)16-6-8-17(9-7-16)15(21)24-4-2/h12H,3-11H2,1-2H3 |
| InChIKey | ZRKZJNIITUKJEH-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 104.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|