C18H24ClN3O4S — CID 108526977
2-[4-(3-chlorophenyl)piperazin-1-yl]-N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-oxoacetamide (PubChem CID 108526977) has the molecular formula C18H24ClN3O4S and a molecular weight of 413.93 g/mol. Its IUPAC name is 2-[4-(3-chlorophenyl)piperazin-1-yl]-N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-oxoacetamide.
| Compound Name | 2-[4-(3-chlorophenyl)piperazin-1-yl]-N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-oxoacetamide |
|---|---|
| PubChem CID | 108526977 |
| Molecular Formula | C18H24ClN3O4S |
| Molecular Weight | 413.93 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 2-[4-(3-chlorophenyl)piperazin-1-yl]-N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-oxoacetamide |
| SMILES | CCN(C(=O)C(=O)N1CCN(c2cccc(Cl)c2)CC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H24ClN3O4S/c1-2-22(16-6-11-27(25,26)13-16)18(24)17(23)21-9-7-20(8-10-21)15-5-3-4-14(19)12-15/h3-5,12,16H,2,6-11,13H2,1H3 |
| InChIKey | CYOVXRDXPSLANL-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.93 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|