C16H21ClN2O4S — CID 108986044
N-[2-(3-chlorophenyl)ethyl]-N'-(1,1-dioxothiolan-3-yl)-N'-ethyloxamide (PubChem CID 108986044) has the molecular formula C16H21ClN2O4S and a molecular weight of 372.87 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-N'-(1,1-dioxothiolan-3-yl)-N'-ethyloxamide.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-N'-(1,1-dioxothiolan-3-yl)-N'-ethyloxamide |
|---|---|
| PubChem CID | 108986044 |
| Molecular Formula | C16H21ClN2O4S |
| Molecular Weight | 372.87 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-N'-(1,1-dioxothiolan-3-yl)-N'-ethyloxamide |
| SMILES | CCN(C(=O)C(=O)NCCc1cccc(Cl)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H21ClN2O4S/c1-2-19(14-7-9-24(22,23)11-14)16(21)15(20)18-8-6-12-4-3-5-13(17)10-12/h3-5,10,14H,2,6-9,11H2,1H3,(H,18,20) |
| InChIKey | DDJRDBPBCKWTMN-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.87 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|