C17H24N2O5S — CID 108505849
N'-(1,1-dioxothiolan-3-yl)-N'-(2-methoxyethyl)-N-(2-phenylethyl)oxamide (PubChem CID 108505849) has the molecular formula C17H24N2O5S and a molecular weight of 368.46 g/mol. Its IUPAC name is N'-(1,1-dioxothiolan-3-yl)-N'-(2-methoxyethyl)-N-(2-phenylethyl)oxamide.
| Compound Name | N'-(1,1-dioxothiolan-3-yl)-N'-(2-methoxyethyl)-N-(2-phenylethyl)oxamide |
|---|---|
| PubChem CID | 108505849 |
| Molecular Formula | C17H24N2O5S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | N'-(1,1-dioxothiolan-3-yl)-N'-(2-methoxyethyl)-N-(2-phenylethyl)oxamide |
| SMILES | COCCN(C(=O)C(=O)NCCc1ccccc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H24N2O5S/c1-24-11-10-19(15-8-12-25(22,23)13-15)17(21)16(20)18-9-7-14-5-3-2-4-6-14/h2-6,15H,7-13H2,1H3,(H,18,20) |
| InChIKey | LGQWKSVJMXMBLO-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|