C23H28N2O5S — CID 108523631
N',N'-dibenzyl-N-(1,1-dioxothiolan-3-yl)-N-(2-methoxyethyl)oxamide (PubChem CID 108523631) has the molecular formula C23H28N2O5S and a molecular weight of 444.55 g/mol. Its IUPAC name is N',N'-dibenzyl-N-(1,1-dioxothiolan-3-yl)-N-(2-methoxyethyl)oxamide.
| Compound Name | N',N'-dibenzyl-N-(1,1-dioxothiolan-3-yl)-N-(2-methoxyethyl)oxamide |
|---|---|
| PubChem CID | 108523631 |
| Molecular Formula | C23H28N2O5S |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | N',N'-dibenzyl-N-(1,1-dioxothiolan-3-yl)-N-(2-methoxyethyl)oxamide |
| SMILES | COCCN(C(=O)C(=O)N(Cc1ccccc1)Cc1ccccc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C23H28N2O5S/c1-30-14-13-25(21-12-15-31(28,29)18-21)23(27)22(26)24(16-19-8-4-2-5-9-19)17-20-10-6-3-7-11-20/h2-11,21H,12-18H2,1H3 |
| InChIKey | ACORSUJALJWZBK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|