C22H26N2O5S — CID 108508056
N-benzhydryl-N'-(1,1-dioxothiolan-3-yl)-N'-(2-methoxyethyl)oxamide (PubChem CID 108508056) has the molecular formula C22H26N2O5S and a molecular weight of 430.53 g/mol. Its IUPAC name is N-benzhydryl-N'-(1,1-dioxothiolan-3-yl)-N'-(2-methoxyethyl)oxamide.
| Compound Name | N-benzhydryl-N'-(1,1-dioxothiolan-3-yl)-N'-(2-methoxyethyl)oxamide |
|---|---|
| PubChem CID | 108508056 |
| Molecular Formula | C22H26N2O5S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | N-benzhydryl-N'-(1,1-dioxothiolan-3-yl)-N'-(2-methoxyethyl)oxamide |
| SMILES | COCCN(C(=O)C(=O)NC(c1ccccc1)c1ccccc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C22H26N2O5S/c1-29-14-13-24(19-12-15-30(27,28)16-19)22(26)21(25)23-20(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-11,19-20H,12-16H2,1H3,(H,23,25) |
| InChIKey | VKZIQSISIHKDPT-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|