C11H20N2O6S — CID 108527246
N'-(1,1-dioxothiolan-3-yl)-N-(2-hydroxyethyl)-N'-(2-methoxyethyl)oxamide (PubChem CID 108527246) has the molecular formula C11H20N2O6S and a molecular weight of 308.36 g/mol. Its IUPAC name is N'-(1,1-dioxothiolan-3-yl)-N-(2-hydroxyethyl)-N'-(2-methoxyethyl)oxamide.
| Compound Name | N'-(1,1-dioxothiolan-3-yl)-N-(2-hydroxyethyl)-N'-(2-methoxyethyl)oxamide |
|---|---|
| PubChem CID | 108527246 |
| Molecular Formula | C11H20N2O6S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | N'-(1,1-dioxothiolan-3-yl)-N-(2-hydroxyethyl)-N'-(2-methoxyethyl)oxamide |
| SMILES | COCCN(C(=O)C(=O)NCCO)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H20N2O6S/c1-19-6-4-13(9-2-7-20(17,18)8-9)11(16)10(15)12-3-5-14/h9,14H,2-8H2,1H3,(H,12,15) |
| InChIKey | HKVISGWRKMQANI-UHFFFAOYSA-N |
| XLogP | -2.24 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|