C16H22N2O6S — CID 108522701
N'-(1,1-dioxothiolan-3-yl)-N-(2-hydroxy-5-methylphenyl)-N'-(2-methoxyethyl)oxamide (PubChem CID 108522701) has the molecular formula C16H22N2O6S and a molecular weight of 370.43 g/mol. Its IUPAC name is N'-(1,1-dioxothiolan-3-yl)-N-(2-hydroxy-5-methylphenyl)-N'-(2-methoxyethyl)oxamide.
| Compound Name | N'-(1,1-dioxothiolan-3-yl)-N-(2-hydroxy-5-methylphenyl)-N'-(2-methoxyethyl)oxamide |
|---|---|
| PubChem CID | 108522701 |
| Molecular Formula | C16H22N2O6S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | N'-(1,1-dioxothiolan-3-yl)-N-(2-hydroxy-5-methylphenyl)-N'-(2-methoxyethyl)oxamide |
| SMILES | COCCN(C(=O)C(=O)Nc1cc(C)ccc1O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H22N2O6S/c1-11-3-4-14(19)13(9-11)17-15(20)16(21)18(6-7-24-2)12-5-8-25(22,23)10-12/h3-4,9,12,19H,5-8,10H2,1-2H3,(H,17,20) |
| InChIKey | DZRVSSAFXCFAJB-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|