C21H24N2O5S2 — CID 108515179
N'-(1,1-dioxothiolan-3-yl)-N'-(2-methoxyethyl)-N-(2-phenylsulfanylphenyl)oxamide (PubChem CID 108515179) has the molecular formula C21H24N2O5S2 and a molecular weight of 448.57 g/mol. Its IUPAC name is N'-(1,1-dioxothiolan-3-yl)-N'-(2-methoxyethyl)-N-(2-phenylsulfanylphenyl)oxamide.
| Compound Name | N'-(1,1-dioxothiolan-3-yl)-N'-(2-methoxyethyl)-N-(2-phenylsulfanylphenyl)oxamide |
|---|---|
| PubChem CID | 108515179 |
| Molecular Formula | C21H24N2O5S2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | N'-(1,1-dioxothiolan-3-yl)-N'-(2-methoxyethyl)-N-(2-phenylsulfanylphenyl)oxamide |
| SMILES | COCCN(C(=O)C(=O)Nc1ccccc1Sc1ccccc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H24N2O5S2/c1-28-13-12-23(16-11-14-30(26,27)15-16)21(25)20(24)22-18-9-5-6-10-19(18)29-17-7-3-2-4-8-17/h2-10,16H,11-15H2,1H3,(H,22,24) |
| InChIKey | YQAIPIJSUDJPKT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|