C15H28N2O5S — CID 108527290
N-tert-butyl-N'-(1,1-dioxothiolan-3-yl)-N-ethyl-N'-(2-methoxyethyl)oxamide (PubChem CID 108527290) has the molecular formula C15H28N2O5S and a molecular weight of 348.47 g/mol. Its IUPAC name is N-tert-butyl-N'-(1,1-dioxothiolan-3-yl)-N-ethyl-N'-(2-methoxyethyl)oxamide.
| Compound Name | N-tert-butyl-N'-(1,1-dioxothiolan-3-yl)-N-ethyl-N'-(2-methoxyethyl)oxamide |
|---|---|
| PubChem CID | 108527290 |
| Molecular Formula | C15H28N2O5S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | N-tert-butyl-N'-(1,1-dioxothiolan-3-yl)-N-ethyl-N'-(2-methoxyethyl)oxamide |
| SMILES | CCN(C(=O)C(=O)N(CCOC)C1CCS(=O)(=O)C1)C(C)(C)C |
| InChI | InChI=1S/C15H28N2O5S/c1-6-17(15(2,3)4)14(19)13(18)16(8-9-22-5)12-7-10-23(20,21)11-12/h12H,6-11H2,1-5H3 |
| InChIKey | BGTLJBJODNMVGU-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|