C16H27N3O7S — CID 108527336
ethyl 4-[2-[(1,1-dioxothiolan-3-yl)-(2-methoxyethyl)amino]-2-oxoacetyl]piperazine-1-carboxylate (PubChem CID 108527336) has the molecular formula C16H27N3O7S and a molecular weight of 405.47 g/mol. Its IUPAC name is ethyl 4-[2-[(1,1-dioxothiolan-3-yl)-(2-methoxyethyl)amino]-2-oxoacetyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[(1,1-dioxothiolan-3-yl)-(2-methoxyethyl)amino]-2-oxoacetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 108527336 |
| Molecular Formula | C16H27N3O7S |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | ethyl 4-[2-[(1,1-dioxothiolan-3-yl)-(2-methoxyethyl)amino]-2-oxoacetyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)C(=O)N(CCOC)C2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C16H27N3O7S/c1-3-26-16(22)18-7-5-17(6-8-18)14(20)15(21)19(9-10-25-2)13-4-11-27(23,24)12-13/h13H,3-12H2,1-2H3 |
| InChIKey | ZURBBHPYSXIXNK-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 113.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|