C16H28N2O5S — CID 108523496
N-(1,1-dioxothiolan-3-yl)-2-(2-ethylpiperidin-1-yl)-N-(2-methoxyethyl)-2-oxoacetamide (PubChem CID 108523496) has the molecular formula C16H28N2O5S and a molecular weight of 360.48 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-(2-ethylpiperidin-1-yl)-N-(2-methoxyethyl)-2-oxoacetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-(2-ethylpiperidin-1-yl)-N-(2-methoxyethyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 108523496 |
| Molecular Formula | C16H28N2O5S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-(2-ethylpiperidin-1-yl)-N-(2-methoxyethyl)-2-oxoacetamide |
| SMILES | CCC1CCCCN1C(=O)C(=O)N(CCOC)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H28N2O5S/c1-3-13-6-4-5-8-17(13)15(19)16(20)18(9-10-23-2)14-7-11-24(21,22)12-14/h13-14H,3-12H2,1-2H3 |
| InChIKey | PMILJXZFJJUCSG-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|