C16H24N2O3S — CID 108988980
1-benzyl-3-(1,1-dioxothiolan-3-yl)-1,3-diethylurea (PubChem CID 108988980) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is 1-benzyl-3-(1,1-dioxothiolan-3-yl)-1,3-diethylurea.
| Compound Name | 1-benzyl-3-(1,1-dioxothiolan-3-yl)-1,3-diethylurea |
|---|---|
| PubChem CID | 108988980 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 1-benzyl-3-(1,1-dioxothiolan-3-yl)-1,3-diethylurea |
| SMILES | CCN(Cc1ccccc1)C(=O)N(CC)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H24N2O3S/c1-3-17(12-14-8-6-5-7-9-14)16(19)18(4-2)15-10-11-22(20,21)13-15/h5-9,15H,3-4,10-13H2,1-2H3 |
| InChIKey | FUVGGAXUMCPMAG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |