C16H21N3O5S — CID 108526478
N'-acetyl-N'-(3-aminophenyl)-N-(1,1-dioxothiolan-3-yl)-N-ethyloxamide (PubChem CID 108526478) has the molecular formula C16H21N3O5S and a molecular weight of 367.43 g/mol. Its IUPAC name is N'-acetyl-N'-(3-aminophenyl)-N-(1,1-dioxothiolan-3-yl)-N-ethyloxamide.
| Compound Name | N'-acetyl-N'-(3-aminophenyl)-N-(1,1-dioxothiolan-3-yl)-N-ethyloxamide |
|---|---|
| PubChem CID | 108526478 |
| Molecular Formula | C16H21N3O5S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | N'-acetyl-N'-(3-aminophenyl)-N-(1,1-dioxothiolan-3-yl)-N-ethyloxamide |
| SMILES | CCN(C(=O)C(=O)N(C(C)=O)c1cccc(N)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H21N3O5S/c1-3-18(14-7-8-25(23,24)10-14)15(21)16(22)19(11(2)20)13-6-4-5-12(17)9-13/h4-6,9,14H,3,7-8,10,17H2,1-2H3 |
| InChIKey | CAWFQDDQHUTRHM-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|