C13H17FN2O3S — CID 61112675
5-amino-N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-fluorobenzamide (PubChem CID 61112675) has the molecular formula C13H17FN2O3S and a molecular weight of 300.35 g/mol. Its IUPAC name is 5-amino-N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-fluorobenzamide.
| Compound Name | 5-amino-N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-fluorobenzamide |
|---|---|
| PubChem CID | 61112675 |
| Molecular Formula | C13H17FN2O3S |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 5-amino-N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-fluorobenzamide |
| SMILES | CCN(C(=O)c1cc(N)ccc1F)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H17FN2O3S/c1-2-16(10-5-6-20(18,19)8-10)13(17)11-7-9(15)3-4-12(11)14/h3-4,7,10H,2,5-6,8,15H2,1H3 |
| InChIKey | AMHOHYLVTJPDGK-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|