C16H24N2O3S — CID 120617449
5-amino-N-butyl-N-(1,1-dioxothiolan-3-yl)-2-methylbenzamide (PubChem CID 120617449) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is 5-amino-N-butyl-N-(1,1-dioxothiolan-3-yl)-2-methylbenzamide.
| Compound Name | 5-amino-N-butyl-N-(1,1-dioxothiolan-3-yl)-2-methylbenzamide |
|---|---|
| PubChem CID | 120617449 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 5-amino-N-butyl-N-(1,1-dioxothiolan-3-yl)-2-methylbenzamide |
| SMILES | CCCCN(C(=O)c1cc(N)ccc1C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H24N2O3S/c1-3-4-8-18(14-7-9-22(20,21)11-14)16(19)15-10-13(17)6-5-12(15)2/h5-6,10,14H,3-4,7-9,11,17H2,1-2H3 |
| InChIKey | QVGGZLBJNQJSBB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|