C25H28N2O3S — CID 75866800
N-butyl-N-(1,1-dioxothiolan-3-yl)-2-(4-methylphenyl)quinoline-4-carboxamide (PubChem CID 75866800) has the molecular formula C25H28N2O3S and a molecular weight of 436.58 g/mol. Its IUPAC name is N-butyl-N-(1,1-dioxothiolan-3-yl)-2-(4-methylphenyl)quinoline-4-carboxamide.
| Compound Name | N-butyl-N-(1,1-dioxothiolan-3-yl)-2-(4-methylphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 75866800 |
| Molecular Formula | C25H28N2O3S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | N-butyl-N-(1,1-dioxothiolan-3-yl)-2-(4-methylphenyl)quinoline-4-carboxamide |
| SMILES | CCCCN(C(=O)c1cc(-c2ccc(C)cc2)nc2ccccc12)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C25H28N2O3S/c1-3-4-14-27(20-13-15-31(29,30)17-20)25(28)22-16-24(19-11-9-18(2)10-12-19)26-23-8-6-5-7-21(22)23/h5-12,16,20H,3-4,13-15,17H2,1-2H3 |
| InChIKey | LLPFMSGZHVIRPV-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |