C15H20INO3S — CID 55377393
N-butyl-N-(1,1-dioxothiolan-3-yl)-3-iodobenzamide (PubChem CID 55377393) has the molecular formula C15H20INO3S and a molecular weight of 421.30 g/mol. Its IUPAC name is N-butyl-N-(1,1-dioxothiolan-3-yl)-3-iodobenzamide.
| Compound Name | N-butyl-N-(1,1-dioxothiolan-3-yl)-3-iodobenzamide |
|---|---|
| PubChem CID | 55377393 |
| Molecular Formula | C15H20INO3S |
| Molecular Weight | 421.30 g/mol |
| Exact Mass | 421.02 |
| IUPAC Name | N-butyl-N-(1,1-dioxothiolan-3-yl)-3-iodobenzamide |
| SMILES | CCCCN(C(=O)c1cccc(I)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H20INO3S/c1-2-3-8-17(14-7-9-21(19,20)11-14)15(18)12-5-4-6-13(16)10-12/h4-6,10,14H,2-3,7-9,11H2,1H3 |
| InChIKey | SILQTUVGTMXWNG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|