C13H14INO5S — CID 60845907
2-[(1,1-dioxothiolan-3-yl)-(3-iodobenzoyl)amino]acetic acid (PubChem CID 60845907) has the molecular formula C13H14INO5S and a molecular weight of 423.23 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)-(3-iodobenzoyl)amino]acetic acid.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)-(3-iodobenzoyl)amino]acetic acid |
|---|---|
| PubChem CID | 60845907 |
| Molecular Formula | C13H14INO5S |
| Molecular Weight | 423.23 g/mol |
| Exact Mass | 422.96 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)-(3-iodobenzoyl)amino]acetic acid |
| SMILES | O=C(O)CN(C(=O)c1cccc(I)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H14INO5S/c14-10-3-1-2-9(6-10)13(18)15(7-12(16)17)11-4-5-21(19,20)8-11/h1-3,6,11H,4-5,7-8H2,(H,16,17) |
| InChIKey | OCZDMELGGQJEDR-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.23 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|