C13H16N2O5S — CID 61213682
2-[(2-aminobenzoyl)-(1,1-dioxothiolan-3-yl)amino]acetic acid (PubChem CID 61213682) has the molecular formula C13H16N2O5S and a molecular weight of 312.35 g/mol. Its IUPAC name is 2-[(2-aminobenzoyl)-(1,1-dioxothiolan-3-yl)amino]acetic acid.
| Compound Name | 2-[(2-aminobenzoyl)-(1,1-dioxothiolan-3-yl)amino]acetic acid |
|---|---|
| PubChem CID | 61213682 |
| Molecular Formula | C13H16N2O5S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 2-[(2-aminobenzoyl)-(1,1-dioxothiolan-3-yl)amino]acetic acid |
| SMILES | Nc1ccccc1C(=O)N(CC(=O)O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H16N2O5S/c14-11-4-2-1-3-10(11)13(18)15(7-12(16)17)9-5-6-21(19,20)8-9/h1-4,9H,5-8,14H2,(H,16,17) |
| InChIKey | LIFZIQKUVYAWMO-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|