C19H18F3NO3S — CID 8781843
N-benzyl-N-[(3R)-1,1-dioxothiolan-3-yl]-3-(trifluoromethyl)benzamide (PubChem CID 8781843) has the molecular formula C19H18F3NO3S and a molecular weight of 397.42 g/mol. Its IUPAC name is N-benzyl-N-[(3R)-1,1-dioxothiolan-3-yl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-benzyl-N-[(3R)-1,1-dioxothiolan-3-yl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 8781843 |
| Molecular Formula | C19H18F3NO3S |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | N-benzyl-N-[(3R)-1,1-dioxothiolan-3-yl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(c1cccc(C(F)(F)F)c1)N(Cc1ccccc1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H18F3NO3S/c20-19(21,22)16-8-4-7-15(11-16)18(24)23(12-14-5-2-1-3-6-14)17-9-10-27(25,26)13-17/h1-8,11,17H,9-10,12-13H2/t17-/m1/s1 |
| InChIKey | QWOZDZDOCCBMGA-QGZVFWFLSA-N |
| XLogP | 3.53 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |