C21H25NO4S — CID 7123222
N-benzyl-N-[(3S)-1,1-dioxothiolan-3-yl]-3-propoxybenzamide (PubChem CID 7123222) has the molecular formula C21H25NO4S and a molecular weight of 387.50 g/mol. Its IUPAC name is N-benzyl-N-[(3S)-1,1-dioxothiolan-3-yl]-3-propoxybenzamide.
| Compound Name | N-benzyl-N-[(3S)-1,1-dioxothiolan-3-yl]-3-propoxybenzamide |
|---|---|
| PubChem CID | 7123222 |
| Molecular Formula | C21H25NO4S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | N-benzyl-N-[(3S)-1,1-dioxothiolan-3-yl]-3-propoxybenzamide |
| SMILES | CCCOc1cccc(C(=O)N(Cc2ccccc2)[C@H]2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C21H25NO4S/c1-2-12-26-20-10-6-9-18(14-20)21(23)22(15-17-7-4-3-5-8-17)19-11-13-27(24,25)16-19/h3-10,14,19H,2,11-13,15-16H2,1H3/t19-/m0/s1 |
| InChIKey | MANMWNRNKXZAOP-IBGZPJMESA-N |
| XLogP | 3.30 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |