C19H19F2NO4S — CID 8781850
N-benzyl-3-(difluoromethoxy)-N-[(3S)-1,1-dioxothiolan-3-yl]benzamide (PubChem CID 8781850) has the molecular formula C19H19F2NO4S and a molecular weight of 395.43 g/mol. Its IUPAC name is N-benzyl-3-(difluoromethoxy)-N-[(3S)-1,1-dioxothiolan-3-yl]benzamide.
| Compound Name | N-benzyl-3-(difluoromethoxy)-N-[(3S)-1,1-dioxothiolan-3-yl]benzamide |
|---|---|
| PubChem CID | 8781850 |
| Molecular Formula | C19H19F2NO4S |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | N-benzyl-3-(difluoromethoxy)-N-[(3S)-1,1-dioxothiolan-3-yl]benzamide |
| SMILES | O=C(c1cccc(OC(F)F)c1)N(Cc1ccccc1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H19F2NO4S/c20-19(21)26-17-8-4-7-15(11-17)18(23)22(12-14-5-2-1-3-6-14)16-9-10-27(24,25)13-16/h1-8,11,16,19H,9-10,12-13H2/t16-/m0/s1 |
| InChIKey | WXHCVRCGVUYRAZ-INIZCTEOSA-N |
| XLogP | 3.12 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |