C21H24FNO4S — CID 18818145
N-(1,1-dioxothiolan-3-yl)-N-[(4-fluorophenyl)methyl]-3-propoxybenzamide (PubChem CID 18818145) has the molecular formula C21H24FNO4S and a molecular weight of 405.49 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-[(4-fluorophenyl)methyl]-3-propoxybenzamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-[(4-fluorophenyl)methyl]-3-propoxybenzamide |
|---|---|
| PubChem CID | 18818145 |
| Molecular Formula | C21H24FNO4S |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-[(4-fluorophenyl)methyl]-3-propoxybenzamide |
| SMILES | CCCOc1cccc(C(=O)N(Cc2ccc(F)cc2)C2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C21H24FNO4S/c1-2-11-27-20-5-3-4-17(13-20)21(24)23(19-10-12-28(25,26)15-19)14-16-6-8-18(22)9-7-16/h3-9,13,19H,2,10-12,14-15H2,1H3 |
| InChIKey | OIOJRTUXVKZPGE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |