C21H27NO5S — CID 40643266
3-butoxy-N-[(3R)-1,1-dioxothiolan-3-yl]-N-[(5-methylfuran-2-yl)methyl]benzamide (PubChem CID 40643266) has the molecular formula C21H27NO5S and a molecular weight of 405.52 g/mol. Its IUPAC name is 3-butoxy-N-[(3R)-1,1-dioxothiolan-3-yl]-N-[(5-methylfuran-2-yl)methyl]benzamide.
| Compound Name | 3-butoxy-N-[(3R)-1,1-dioxothiolan-3-yl]-N-[(5-methylfuran-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 40643266 |
| Molecular Formula | C21H27NO5S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 3-butoxy-N-[(3R)-1,1-dioxothiolan-3-yl]-N-[(5-methylfuran-2-yl)methyl]benzamide |
| SMILES | CCCCOc1cccc(C(=O)N(Cc2ccc(C)o2)[C@@H]2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C21H27NO5S/c1-3-4-11-26-19-7-5-6-17(13-19)21(23)22(14-20-9-8-16(2)27-20)18-10-12-28(24,25)15-18/h5-9,13,18H,3-4,10-12,14-15H2,1-2H3/t18-/m1/s1 |
| InChIKey | HKJKSVJLBFZCAW-GOSISDBHSA-N |
| XLogP | 3.60 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|