C25H27NO4S — CID 40851271
N-[(3S)-1,1-dioxothiolan-3-yl]-N-(naphthalen-1-ylmethyl)-3-propoxybenzamide (PubChem CID 40851271) has the molecular formula C25H27NO4S and a molecular weight of 437.56 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-N-(naphthalen-1-ylmethyl)-3-propoxybenzamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-N-(naphthalen-1-ylmethyl)-3-propoxybenzamide |
|---|---|
| PubChem CID | 40851271 |
| Molecular Formula | C25H27NO4S |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-N-(naphthalen-1-ylmethyl)-3-propoxybenzamide |
| SMILES | CCCOc1cccc(C(=O)N(Cc2cccc3ccccc23)[C@H]2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C25H27NO4S/c1-2-14-30-23-11-6-9-20(16-23)25(27)26(22-13-15-31(28,29)18-22)17-21-10-5-8-19-7-3-4-12-24(19)21/h3-12,16,22H,2,13-15,17-18H2,1H3/t22-/m0/s1 |
| InChIKey | JKZIUPHJNUVUED-QFIPXVFZSA-N |
| XLogP | 4.46 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |