C22H21NO3S — CID 40851276
N-[(3R)-1,1-dioxothiolan-3-yl]-N-(naphthalen-1-ylmethyl)benzamide (PubChem CID 40851276) has the molecular formula C22H21NO3S and a molecular weight of 379.48 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-N-(naphthalen-1-ylmethyl)benzamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-N-(naphthalen-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 40851276 |
| Molecular Formula | C22H21NO3S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-N-(naphthalen-1-ylmethyl)benzamide |
| SMILES | O=C(c1ccccc1)N(Cc1cccc2ccccc12)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C22H21NO3S/c24-22(18-8-2-1-3-9-18)23(20-13-14-27(25,26)16-20)15-19-11-6-10-17-7-4-5-12-21(17)19/h1-12,20H,13-16H2/t20-/m1/s1 |
| InChIKey | PROIAWIRNZTCDZ-HXUWFJFHSA-N |
| XLogP | 3.67 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |