C22H20N2O5S — CID 40851257
N-[(3R)-1,1-dioxothiolan-3-yl]-N-(naphthalen-1-ylmethyl)-3-nitrobenzamide (PubChem CID 40851257) has the molecular formula C22H20N2O5S and a molecular weight of 424.48 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-N-(naphthalen-1-ylmethyl)-3-nitrobenzamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-N-(naphthalen-1-ylmethyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 40851257 |
| Molecular Formula | C22H20N2O5S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-N-(naphthalen-1-ylmethyl)-3-nitrobenzamide |
| SMILES | O=C(c1cccc([N+](=O)[O-])c1)N(Cc1cccc2ccccc12)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C22H20N2O5S/c25-22(17-7-4-9-19(13-17)24(26)27)23(20-11-12-30(28,29)15-20)14-18-8-3-6-16-5-1-2-10-21(16)18/h1-10,13,20H,11-12,14-15H2/t20-/m1/s1 |
| InChIKey | TTZPQWFKNNDRPH-HXUWFJFHSA-N |
| XLogP | 3.58 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|