C22H20BrNO3S — CID 40851191
4-bromo-N-[(3S)-1,1-dioxothiolan-3-yl]-N-(naphthalen-1-ylmethyl)benzamide (PubChem CID 40851191) has the molecular formula C22H20BrNO3S and a molecular weight of 458.38 g/mol. Its IUPAC name is 4-bromo-N-[(3S)-1,1-dioxothiolan-3-yl]-N-(naphthalen-1-ylmethyl)benzamide.
| Compound Name | 4-bromo-N-[(3S)-1,1-dioxothiolan-3-yl]-N-(naphthalen-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 40851191 |
| Molecular Formula | C22H20BrNO3S |
| Molecular Weight | 458.38 g/mol |
| Exact Mass | 457.03 |
| IUPAC Name | 4-bromo-N-[(3S)-1,1-dioxothiolan-3-yl]-N-(naphthalen-1-ylmethyl)benzamide |
| SMILES | O=C(c1ccc(Br)cc1)N(Cc1cccc2ccccc12)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C22H20BrNO3S/c23-19-10-8-17(9-11-19)22(25)24(20-12-13-28(26,27)15-20)14-18-6-3-5-16-4-1-2-7-21(16)18/h1-11,20H,12-15H2/t20-/m0/s1 |
| InChIKey | ZZKVUJIFIQRETL-FQEVSTJZSA-N |
| XLogP | 4.43 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |