C14H17NO3S — CID 7476902
N-[(3R)-1,1-dioxothiolan-3-yl]-N-prop-2-enylbenzamide (PubChem CID 7476902) has the molecular formula C14H17NO3S and a molecular weight of 279.36 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-N-prop-2-enylbenzamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 7476902 |
| Molecular Formula | C14H17NO3S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-N-prop-2-enylbenzamide |
| SMILES | C=CCN(C(=O)c1ccccc1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H17NO3S/c1-2-9-15(13-8-10-19(17,18)11-13)14(16)12-6-4-3-5-7-12/h2-7,13H,1,8-11H2/t13-/m1/s1 |
| InChIKey | HEQPSZMLKOQXJZ-CYBMUJFWSA-N |
| XLogP | 1.50 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|