C16H18N2O3S — CID 94820885
N-[(3S)-1,1-dioxothiolan-3-yl]-N-prop-2-enyl-1H-indole-2-carboxamide (PubChem CID 94820885) has the molecular formula C16H18N2O3S and a molecular weight of 318.40 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-N-prop-2-enyl-1H-indole-2-carboxamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-N-prop-2-enyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 94820885 |
| Molecular Formula | C16H18N2O3S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-N-prop-2-enyl-1H-indole-2-carboxamide |
| SMILES | C=CCN(C(=O)c1cc2ccccc2[nH]1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H18N2O3S/c1-2-8-18(13-7-9-22(20,21)11-13)16(19)15-10-12-5-3-4-6-14(12)17-15/h2-6,10,13,17H,1,7-9,11H2/t13-/m0/s1 |
| InChIKey | JREZZBOMODSTJN-ZDUSSCGKSA-N |
| XLogP | 1.98 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|