C10H17NO3S — CID 99975558
N-[(3R)-1,1-dioxothiolan-3-yl]-N-prop-2-enylpropanamide (PubChem CID 99975558) has the molecular formula C10H17NO3S and a molecular weight of 231.32 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-N-prop-2-enylpropanamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 99975558 |
| Molecular Formula | C10H17NO3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-N-prop-2-enylpropanamide |
| SMILES | C=CCN(C(=O)CC)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H17NO3S/c1-3-6-11(10(12)4-2)9-5-7-15(13,14)8-9/h3,9H,1,4-8H2,2H3/t9-/m1/s1 |
| InChIKey | BUBHSZCSVPHYJE-SECBINFHSA-N |
| XLogP | 0.60 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|