C10H19NO2S — CID 70659127
(3S)-1,1-dioxo-N-propan-2-yl-N-prop-2-enylthiolan-3-amine (PubChem CID 70659127) has the molecular formula C10H19NO2S and a molecular weight of 217.33 g/mol. Its IUPAC name is (3S)-1,1-dioxo-N-propan-2-yl-N-prop-2-enylthiolan-3-amine.
| Compound Name | (3S)-1,1-dioxo-N-propan-2-yl-N-prop-2-enylthiolan-3-amine |
|---|---|
| PubChem CID | 70659127 |
| Molecular Formula | C10H19NO2S |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | (3S)-1,1-dioxo-N-propan-2-yl-N-prop-2-enylthiolan-3-amine |
| SMILES | C=CCN(C(C)C)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H19NO2S/c1-4-6-11(9(2)3)10-5-7-14(12,13)8-10/h4,9-10H,1,5-8H2,2-3H3/t10-/m0/s1 |
| InChIKey | FLXAZERQYFKMMK-JTQLQIEISA-N |
| XLogP | 1.07 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|