C10H16N2O3S — CID 82118099
3-cyano-N-(1,1-dioxothiolan-3-yl)-N,2-dimethylpropanamide (PubChem CID 82118099) has the molecular formula C10H16N2O3S and a molecular weight of 244.32 g/mol. Its IUPAC name is 3-cyano-N-(1,1-dioxothiolan-3-yl)-N,2-dimethylpropanamide.
| Compound Name | 3-cyano-N-(1,1-dioxothiolan-3-yl)-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 82118099 |
| Molecular Formula | C10H16N2O3S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 3-cyano-N-(1,1-dioxothiolan-3-yl)-N,2-dimethylpropanamide |
| SMILES | CC(CC#N)C(=O)N(C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H16N2O3S/c1-8(3-5-11)10(13)12(2)9-4-6-16(14,15)7-9/h8-9H,3-4,6-7H2,1-2H3 |
| InChIKey | OGJUAEDKMKPOJK-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 78.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |