C11H22N2O3S — CID 76893547
2-amino-N-(1,1-dioxothiolan-3-yl)-N,3,3-trimethylbutanamide (PubChem CID 76893547) has the molecular formula C11H22N2O3S and a molecular weight of 262.37 g/mol. Its IUPAC name is 2-amino-N-(1,1-dioxothiolan-3-yl)-N,3,3-trimethylbutanamide.
| Compound Name | 2-amino-N-(1,1-dioxothiolan-3-yl)-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 76893547 |
| Molecular Formula | C11H22N2O3S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 2-amino-N-(1,1-dioxothiolan-3-yl)-N,3,3-trimethylbutanamide |
| SMILES | CN(C(=O)C(N)C(C)(C)C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H22N2O3S/c1-11(2,3)9(12)10(14)13(4)8-5-6-17(15,16)7-8/h8-9H,5-7,12H2,1-4H3 |
| InChIKey | MQVFTGOHKITSAM-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |