C9H18N2O3S — CID 61266565
2-amino-N-(1,1-dioxothiolan-3-yl)-N,2-dimethylpropanamide (PubChem CID 61266565) has the molecular formula C9H18N2O3S and a molecular weight of 234.32 g/mol. Its IUPAC name is 2-amino-N-(1,1-dioxothiolan-3-yl)-N,2-dimethylpropanamide.
| Compound Name | 2-amino-N-(1,1-dioxothiolan-3-yl)-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 61266565 |
| Molecular Formula | C9H18N2O3S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 2-amino-N-(1,1-dioxothiolan-3-yl)-N,2-dimethylpropanamide |
| SMILES | CN(C(=O)C(C)(C)N)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H18N2O3S/c1-9(2,10)8(12)11(3)7-4-5-15(13,14)6-7/h7H,4-6,10H2,1-3H3 |
| InChIKey | LCRZJZHCKXLXAB-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |