C10H17NO5S — CID 82821840
3-[(1,1-dioxothiolan-3-yl)-methylamino]-2,2-dimethyl-3-oxopropanoic acid (PubChem CID 82821840) has the molecular formula C10H17NO5S and a molecular weight of 263.31 g/mol. Its IUPAC name is 3-[(1,1-dioxothiolan-3-yl)-methylamino]-2,2-dimethyl-3-oxopropanoic acid.
| Compound Name | 3-[(1,1-dioxothiolan-3-yl)-methylamino]-2,2-dimethyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 82821840 |
| Molecular Formula | C10H17NO5S |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 3-[(1,1-dioxothiolan-3-yl)-methylamino]-2,2-dimethyl-3-oxopropanoic acid |
| SMILES | CN(C(=O)C(C)(C)C(=O)O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H17NO5S/c1-10(2,9(13)14)8(12)11(3)7-4-5-17(15,16)6-7/h7H,4-6H2,1-3H3,(H,13,14) |
| InChIKey | CZEGNWJPCFIPMQ-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|