C17H28N2O6S — CID 108964719
3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-N-(1,1-dioxothiolan-3-yl)-N,2,2-trimethyl-3-oxopropanamide (PubChem CID 108964719) has the molecular formula C17H28N2O6S and a molecular weight of 388.49 g/mol. Its IUPAC name is 3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-N-(1,1-dioxothiolan-3-yl)-N,2,2-trimethyl-3-oxopropanamide.
| Compound Name | 3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-N-(1,1-dioxothiolan-3-yl)-N,2,2-trimethyl-3-oxopropanamide |
|---|---|
| PubChem CID | 108964719 |
| Molecular Formula | C17H28N2O6S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 3-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-N-(1,1-dioxothiolan-3-yl)-N,2,2-trimethyl-3-oxopropanamide |
| SMILES | CN(C(=O)C(C)(C)C(=O)N1CCC2(CC1)OCCO2)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H28N2O6S/c1-16(2,14(20)18(3)13-4-11-26(22,23)12-13)15(21)19-7-5-17(6-8-19)24-9-10-25-17/h13H,4-12H2,1-3H3 |
| InChIKey | WHBRPSCJFDEOGU-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|