C11H20N2O5S2 — CID 108989373
1,3-bis(1,1-dioxothiolan-3-yl)-1,3-dimethylurea (PubChem CID 108989373) has the molecular formula C11H20N2O5S2 and a molecular weight of 324.42 g/mol. Its IUPAC name is 1,3-bis(1,1-dioxothiolan-3-yl)-1,3-dimethylurea.
| Compound Name | 1,3-bis(1,1-dioxothiolan-3-yl)-1,3-dimethylurea |
|---|---|
| PubChem CID | 108989373 |
| Molecular Formula | C11H20N2O5S2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 1,3-bis(1,1-dioxothiolan-3-yl)-1,3-dimethylurea |
| SMILES | CN(C(=O)N(C)C1CCS(=O)(=O)C1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H20N2O5S2/c1-12(9-3-5-19(15,16)7-9)11(14)13(2)10-4-6-20(17,18)8-10/h9-10H,3-8H2,1-2H3 |
| InChIKey | XIQRRHPPAWXNMU-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |