C12H20N2O4S6 — CID 6580252
[[(3S)-1,1-dioxothiolan-3-yl]-methylcarbamothioyl]sulfanyl N-[(3S)-1,1-dioxothiolan-3-yl]-N-methylcarbamodithioate (PubChem CID 6580252) has the molecular formula C12H20N2O4S6 and a molecular weight of 448.70 g/mol. Its IUPAC name is [[(3S)-1,1-dioxothiolan-3-yl]-methylcarbamothioyl]sulfanyl N-[(3S)-1,1-dioxothiolan-3-yl]-N-methylcarbamodithioate.
| Compound Name | [[(3S)-1,1-dioxothiolan-3-yl]-methylcarbamothioyl]sulfanyl N-[(3S)-1,1-dioxothiolan-3-yl]-N-methylcarbamodithioate |
|---|---|
| PubChem CID | 6580252 |
| Molecular Formula | C12H20N2O4S6 |
| Molecular Weight | 448.70 g/mol |
| Exact Mass | 447.97 |
| IUPAC Name | [[(3S)-1,1-dioxothiolan-3-yl]-methylcarbamothioyl]sulfanyl N-[(3S)-1,1-dioxothiolan-3-yl]-N-methylcarbamodithioate |
| SMILES | CN(C(=S)SSC(=S)N(C)[C@H]1CCS(=O)(=O)C1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H20N2O4S6/c1-13(9-3-5-23(15,16)7-9)11(19)21-22-12(20)14(2)10-4-6-24(17,18)8-10/h9-10H,3-8H2,1-2H3/t9-,10-/m0/s1 |
| InChIKey | MUETWXQELDDWNM-UWVGGRQHSA-N |
| XLogP | 1.18 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.70 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|