C10H19NO2S3 — CID 40507251
butyl N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylcarbamodithioate (PubChem CID 40507251) has the molecular formula C10H19NO2S3 and a molecular weight of 281.47 g/mol. Its IUPAC name is butyl N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylcarbamodithioate.
| Compound Name | butyl N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylcarbamodithioate |
|---|---|
| PubChem CID | 40507251 |
| Molecular Formula | C10H19NO2S3 |
| Molecular Weight | 281.47 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | butyl N-[(3R)-1,1-dioxothiolan-3-yl]-N-methylcarbamodithioate |
| SMILES | CCCCSC(=S)N(C)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H19NO2S3/c1-3-4-6-15-10(14)11(2)9-5-7-16(12,13)8-9/h9H,3-8H2,1-2H3/t9-/m1/s1 |
| InChIKey | YFEXIWZEMKUNSS-SECBINFHSA-N |
| XLogP | 1.92 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.47 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|