C9H18N2O2S — CID 63176291
N-(1,1-dioxothiolan-3-yl)-N-methylbutanimidamide (PubChem CID 63176291) has the molecular formula C9H18N2O2S and a molecular weight of 218.32 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-methylbutanimidamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-methylbutanimidamide |
|---|---|
| PubChem CID | 63176291 |
| Molecular Formula | C9H18N2O2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-methylbutanimidamide |
| SMILES | [H]/N=C(\CCC)N(C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H18N2O2S/c1-3-4-9(10)11(2)8-5-6-14(12,13)7-8/h8,10H,3-7H2,1-2H3/b10-9+ |
| InChIKey | QOWRBRPLOHODCH-MDZDMXLPSA-N |
| XLogP | 0.88 |
| TPSA | 61.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|