C9H16N2O4S — CID 110687013
2-acetamido-N-(1,1-dioxothiolan-3-yl)-N-methylacetamide (PubChem CID 110687013) has the molecular formula C9H16N2O4S and a molecular weight of 248.30 g/mol. Its IUPAC name is 2-acetamido-N-(1,1-dioxothiolan-3-yl)-N-methylacetamide.
| Compound Name | 2-acetamido-N-(1,1-dioxothiolan-3-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 110687013 |
| Molecular Formula | C9H16N2O4S |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 2-acetamido-N-(1,1-dioxothiolan-3-yl)-N-methylacetamide |
| SMILES | CC(=O)NCC(=O)N(C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H16N2O4S/c1-7(12)10-5-9(13)11(2)8-3-4-16(14,15)6-8/h8H,3-6H2,1-2H3,(H,10,12) |
| InChIKey | WRAJVSQTNYPFSD-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |