C8H14N2O5S — CID 43649063
2-[[(1,1-dioxothiolan-3-yl)-methylcarbamoyl]amino]acetic acid (PubChem CID 43649063) has the molecular formula C8H14N2O5S and a molecular weight of 250.28 g/mol. Its IUPAC name is 2-[[(1,1-dioxothiolan-3-yl)-methylcarbamoyl]amino]acetic acid.
| Compound Name | 2-[[(1,1-dioxothiolan-3-yl)-methylcarbamoyl]amino]acetic acid |
|---|---|
| PubChem CID | 43649063 |
| Molecular Formula | C8H14N2O5S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 2-[[(1,1-dioxothiolan-3-yl)-methylcarbamoyl]amino]acetic acid |
| SMILES | CN(C(=O)NCC(=O)O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H14N2O5S/c1-10(8(13)9-4-7(11)12)6-2-3-16(14,15)5-6/h6H,2-5H2,1H3,(H,9,13)(H,11,12) |
| InChIKey | GZABGQZJDVDNCF-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |