C21H26N2O3S — CID 42885771
1-(1,1-dioxothiolan-3-yl)-3-(3,3-diphenylpropyl)-1-methylurea (PubChem CID 42885771) has the molecular formula C21H26N2O3S and a molecular weight of 386.52 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-(3,3-diphenylpropyl)-1-methylurea.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-(3,3-diphenylpropyl)-1-methylurea |
|---|---|
| PubChem CID | 42885771 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-(3,3-diphenylpropyl)-1-methylurea |
| SMILES | CN(C(=O)NCCC(c1ccccc1)c1ccccc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H26N2O3S/c1-23(19-13-15-27(25,26)16-19)21(24)22-14-12-20(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-11,19-20H,12-16H2,1H3,(H,22,24) |
| InChIKey | VJKJBSLHCICELX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |