C10H19NO3S — CID 3450541
N-(1,1-dioxothiolan-3-yl)-N,3-dimethylbutanamide (PubChem CID 3450541) has the molecular formula C10H19NO3S and a molecular weight of 233.33 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N,3-dimethylbutanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 3450541 |
| Molecular Formula | C10H19NO3S |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N,3-dimethylbutanamide |
| SMILES | CC(C)CC(=O)N(C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H19NO3S/c1-8(2)6-10(12)11(3)9-4-5-15(13,14)7-9/h8-9H,4-7H2,1-3H3 |
| InChIKey | UBBGZHCUXMJPOH-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |