C8H16N2O3S — CID 78971907
(2R)-2-amino-N-(1,1-dioxothiolan-3-yl)-N-methylpropanamide (PubChem CID 78971907) has the molecular formula C8H16N2O3S and a molecular weight of 220.29 g/mol. Its IUPAC name is (2R)-2-amino-N-(1,1-dioxothiolan-3-yl)-N-methylpropanamide.
| Compound Name | (2R)-2-amino-N-(1,1-dioxothiolan-3-yl)-N-methylpropanamide |
|---|---|
| PubChem CID | 78971907 |
| Molecular Formula | C8H16N2O3S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | (2R)-2-amino-N-(1,1-dioxothiolan-3-yl)-N-methylpropanamide |
| SMILES | C[C@@H](N)C(=O)N(C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H16N2O3S/c1-6(9)8(11)10(2)7-3-4-14(12,13)5-7/h6-7H,3-5,9H2,1-2H3/t6-,7?/m1/s1 |
| InChIKey | WMFXQTPDGQKCIF-ULUSZKPHSA-N |
| XLogP | -1.02 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |